milli893 milli893
  • 01-10-2018
  • History
contestada

Why did students gather in Tiananmen Square on June 4 1989

Respuesta :

faithbowenp6rmu0
faithbowenp6rmu0 faithbowenp6rmu0
  • 01-10-2018
The students gathered to demand greater political openness in 1989
Answer Link

Otras preguntas

Calculate the number of grams of oxygen present in 1.75 moles of calcium carbonate
Three lots with parallel side boundaries extend from the avenue to the boulevard as shown answer
Which of these is a modern day result of the Spanish colonization of the americas
PLZ ANSWER NOW What is the value of the expression (2.3 × 107)(1.4 × 10−2) written in scientific notation?
What’s the answer for m<1?
Jason argues that oversimplification is a problem when writing a cause-and-effect paragraph. Sally maintains that confusing cause and effect can be a serious pr
Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)
what is a chemical bond
"Public concert in the Square this Saturday night; white section-first 10 rows." How could this advertisement be reworded to comply with the Civil Rights Act of
Briefly describe scientific notation. how is it useful for writing large and small​ numbers? how is it useful for making​ approximations?