kai2492 kai2492

01-03-2021
History

contestada

How did cultural diffusion impact the world thanks to the expansion of the Mongol Empire?

How did cultural diffusion impact the world thanks to the expansion of the Mongol Empire class=

Respuesta :

terelopezgonzalez6 terelopezgonzalez6

01-03-2021

Answer:

Explanation:Al mismo tiempo, el imperio mongol también dejó un importante legado cultural. A pesar de sus duras estrategias de conquista, a nivel religioso se practicó la libertad de culto y la tolerancia a las diferentes tradiciones.

Answer Link

Otras preguntas

4/7(4x+3)-1/7(9x+5)

How do l calculate e nergy

What religion did the Roman Empire and Byzantine Empire follow

Tomorrow is Homecoming and a lot of alumni are coming back to see. * O simple O Complex O Compound-Complex compound

cosec(6b+pi/8)=sec(2b-pi/8)

Eight times the sum of a number and 6 equals 2

Find the distance between (-3,5) and (4,-2)

Ted is comparing the temperatures of three days in January. The temperatures on Monday and Tuesday were opposites. The temperature on Wednesday was neither posi

Does the sentence state a fact or an opinion? Polar bears in the wild live on thousands of miles of open space, so when they are confined to zoo exhibits that a

A hot air balloon rises at a rate of 38 km/h and starts at the height of 60 km. Another balloon started from the ground and is rising at the rate of 50 km/h. At