br4JamdgshaNicolly br4JamdgshaNicolly
  • 04-04-2017
  • Physics
contestada

Scietist who studies the forces that make and shape planet earth

Respuesta :

xpjackiexp
xpjackiexp xpjackiexp
  • 04-04-2017
geologists study the chemical and physical characteristics of rock that make up the earths surface
Answer Link

Otras preguntas

How did the Weimar Republic fail
What’s the slope ? I don’t understand
Rewrite standard form equation in graphing form and then sketch the graph p(x) =x^2- 10x +16 f(x)=x^2+ 3x-10 g(x)=x^2- 4x -2 h(x)=-4x^2+ 4x+8
What are temperature lines and Illumination zones? ​
I forgot what length width height V stands for in mathematics cubic feet can someone help me
cosec(6b+pi/8)=sec(2b-pi/8)​
Who’s views did the Democratic Republicans represent?
how did Charles Wallace speak when he first learn to talk​
while doing an experiment a physics student recorded the following sequence of elapsed times (in seconds) in a lab notebook 2.02 24.6 2.88 2.18 2.78 2.35 2.22 t
Change 65 out of 200 to a percentage